C10H12F2N2OS — CID 119315962
3-amino-N-[3-(difluoromethylsulfanyl)phenyl]propanamide (PubChem CID 119315962) has the molecular formula C10H12F2N2OS and a molecular weight of 246.28 g/mol. Its IUPAC name is 3-amino-N-[3-(difluoromethylsulfanyl)phenyl]propanamide.
| Compound Name | 3-amino-N-[3-(difluoromethylsulfanyl)phenyl]propanamide |
|---|---|
| PubChem CID | 119315962 |
| Molecular Formula | C10H12F2N2OS |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 3-amino-N-[3-(difluoromethylsulfanyl)phenyl]propanamide |
| SMILES | NCCC(=O)Nc1cccc(SC(F)F)c1 |
| InChI | InChI=1S/C10H12F2N2OS/c11-10(12)16-8-3-1-2-7(6-8)14-9(15)4-5-13/h1-3,6,10H,4-5,13H2,(H,14,15) |
| InChIKey | LUBUNUHGJIJKSP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |