C9H9F2NOS — CID 4963031
N-[3-(difluoromethylsulfanyl)phenyl]acetamide (PubChem CID 4963031) has the molecular formula C9H9F2NOS and a molecular weight of 217.24 g/mol. Its IUPAC name is N-[3-(difluoromethylsulfanyl)phenyl]acetamide.
| Compound Name | N-[3-(difluoromethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 4963031 |
| Molecular Formula | C9H9F2NOS |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | N-[3-(difluoromethylsulfanyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(SC(F)F)c1 |
| InChI | InChI=1S/C9H9F2NOS/c1-6(13)12-7-3-2-4-8(5-7)14-9(10)11/h2-5,9H,1H3,(H,12,13) |
| InChIKey | KBCXUEJCIUUSJV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |