C15H20F2N2OS — CID 75371994
1-[3-(difluoromethylsulfanyl)phenyl]-3-(1-methylcyclohexyl)urea (PubChem CID 75371994) has the molecular formula C15H20F2N2OS and a molecular weight of 314.40 g/mol. Its IUPAC name is 1-[3-(difluoromethylsulfanyl)phenyl]-3-(1-methylcyclohexyl)urea.
| Compound Name | 1-[3-(difluoromethylsulfanyl)phenyl]-3-(1-methylcyclohexyl)urea |
|---|---|
| PubChem CID | 75371994 |
| Molecular Formula | C15H20F2N2OS |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-[3-(difluoromethylsulfanyl)phenyl]-3-(1-methylcyclohexyl)urea |
| SMILES | CC1(NC(=O)Nc2cccc(SC(F)F)c2)CCCCC1 |
| InChI | InChI=1S/C15H20F2N2OS/c1-15(8-3-2-4-9-15)19-14(20)18-11-6-5-7-12(10-11)21-13(16)17/h5-7,10,13H,2-4,8-9H2,1H3,(H2,18,19,20) |
| InChIKey | ASJVPPKWVDIUJN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |