C15H22N2O2S — CID 72860999
1-[1-(methoxymethyl)cyclopentyl]-3-(3-methylsulfanylphenyl)urea (PubChem CID 72860999) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is 1-[1-(methoxymethyl)cyclopentyl]-3-(3-methylsulfanylphenyl)urea.
| Compound Name | 1-[1-(methoxymethyl)cyclopentyl]-3-(3-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 72860999 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 1-[1-(methoxymethyl)cyclopentyl]-3-(3-methylsulfanylphenyl)urea |
| SMILES | COCC1(NC(=O)Nc2cccc(SC)c2)CCCC1 |
| InChI | InChI=1S/C15H22N2O2S/c1-19-11-15(8-3-4-9-15)17-14(18)16-12-6-5-7-13(10-12)20-2/h5-7,10H,3-4,8-9,11H2,1-2H3,(H2,16,17,18) |
| InChIKey | FVKWWLAXWZCCEN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |