C12H17ClF2N2OS — CID 119770513
N-[3-(difluoromethylsulfanyl)phenyl]-4-(methylamino)butanamide;hydrochloride (PubChem CID 119770513) has the molecular formula C12H17ClF2N2OS and a molecular weight of 310.80 g/mol. Its IUPAC name is N-[3-(difluoromethylsulfanyl)phenyl]-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-[3-(difluoromethylsulfanyl)phenyl]-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119770513 |
| Molecular Formula | C12H17ClF2N2OS |
| Molecular Weight | 310.80 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | N-[3-(difluoromethylsulfanyl)phenyl]-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)Nc1cccc(SC(F)F)c1.Cl |
| InChI | InChI=1S/C12H16F2N2OS.ClH/c1-15-7-3-6-11(17)16-9-4-2-5-10(8-9)18-12(13)14;/h2,4-5,8,12,15H,3,6-7H2,1H3,(H,16,17);1H |
| InChIKey | JYMHJBYWIMYBTQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.80 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|