C11H17ClN2O — CID 75493451
4-(methylamino)-N-phenylbutanamide;hydrochloride (PubChem CID 75493451) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is 4-(methylamino)-N-phenylbutanamide;hydrochloride.
| Compound Name | 4-(methylamino)-N-phenylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 75493451 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-(methylamino)-N-phenylbutanamide;hydrochloride |
| SMILES | CNCCCC(=O)Nc1ccccc1.Cl |
| InChI | InChI=1S/C11H16N2O.ClH/c1-12-9-5-8-11(14)13-10-6-3-2-4-7-10;/h2-4,6-7,12H,5,8-9H2,1H3,(H,13,14);1H |
| InChIKey | LLFRZIGXQBHWNF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|