C13H18N2O2 — CID 61258439
N-(4-acetylphenyl)-4-(methylamino)butanamide (PubChem CID 61258439) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is N-(4-acetylphenyl)-4-(methylamino)butanamide.
| Compound Name | N-(4-acetylphenyl)-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 61258439 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | N-(4-acetylphenyl)-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C13H18N2O2/c1-10(16)11-5-7-12(8-6-11)15-13(17)4-3-9-14-2/h5-8,14H,3-4,9H2,1-2H3,(H,15,17) |
| InChIKey | HIHIYWVSHDYYDC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|