C14H24ClN3O2S — CID 119764489
N-[3-[(2-amino-2-methylpentanoyl)amino]propyl]thiophene-2-carboxamide;hydrochloride (PubChem CID 119764489) has the molecular formula C14H24ClN3O2S and a molecular weight of 333.89 g/mol. Its IUPAC name is N-[3-[(2-amino-2-methylpentanoyl)amino]propyl]thiophene-2-carboxamide;hydrochloride.
| Compound Name | N-[3-[(2-amino-2-methylpentanoyl)amino]propyl]thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119764489 |
| Molecular Formula | C14H24ClN3O2S |
| Molecular Weight | 333.89 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | N-[3-[(2-amino-2-methylpentanoyl)amino]propyl]thiophene-2-carboxamide;hydrochloride |
| SMILES | CCCC(C)(N)C(=O)NCCCNC(=O)c1cccs1.Cl |
| InChI | InChI=1S/C14H23N3O2S.ClH/c1-3-7-14(2,15)13(19)17-9-5-8-16-12(18)11-6-4-10-20-11;/h4,6,10H,3,5,7-9,15H2,1-2H3,(H,16,18)(H,17,19);1H |
| InChIKey | CQIFVNPLLQGDRO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.89 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|