C18H24ClN3O2S — CID 119643191
N-[3-[(2-amino-2-ethylbutyl)carbamoyl]phenyl]thiophene-2-carboxamide;hydrochloride (PubChem CID 119643191) has the molecular formula C18H24ClN3O2S and a molecular weight of 381.93 g/mol. Its IUPAC name is N-[3-[(2-amino-2-ethylbutyl)carbamoyl]phenyl]thiophene-2-carboxamide;hydrochloride.
| Compound Name | N-[3-[(2-amino-2-ethylbutyl)carbamoyl]phenyl]thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119643191 |
| Molecular Formula | C18H24ClN3O2S |
| Molecular Weight | 381.93 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | N-[3-[(2-amino-2-ethylbutyl)carbamoyl]phenyl]thiophene-2-carboxamide;hydrochloride |
| SMILES | CCC(N)(CC)CNC(=O)c1cccc(NC(=O)c2cccs2)c1.Cl |
| InChI | InChI=1S/C18H23N3O2S.ClH/c1-3-18(19,4-2)12-20-16(22)13-7-5-8-14(11-13)21-17(23)15-9-6-10-24-15;/h5-11H,3-4,12,19H2,1-2H3,(H,20,22)(H,21,23);1H |
| InChIKey | GSTDNBASMGJUJC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.93 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |