C16H29Cl2N3O — CID 119641082
N-(2-amino-2-ethylbutyl)-3-[(dimethylamino)methyl]benzamide;dihydrochloride (PubChem CID 119641082) has the molecular formula C16H29Cl2N3O and a molecular weight of 350.33 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-3-[(dimethylamino)methyl]benzamide;dihydrochloride.
| Compound Name | N-(2-amino-2-ethylbutyl)-3-[(dimethylamino)methyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119641082 |
| Molecular Formula | C16H29Cl2N3O |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-3-[(dimethylamino)methyl]benzamide;dihydrochloride |
| SMILES | CCC(N)(CC)CNC(=O)c1cccc(CN(C)C)c1.Cl.Cl |
| InChI | InChI=1S/C16H27N3O.2ClH/c1-5-16(17,6-2)12-18-15(20)14-9-7-8-13(10-14)11-19(3)4;;/h7-10H,5-6,11-12,17H2,1-4H3,(H,18,20);2*1H |
| InChIKey | OVUDQMPWYVLESW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |