C19H21N3O3S — CID 18157126
N-[3-[(3-oxo-3-pyrrolidin-1-ylpropyl)carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 18157126) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is N-[3-[(3-oxo-3-pyrrolidin-1-ylpropyl)carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[(3-oxo-3-pyrrolidin-1-ylpropyl)carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 18157126 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[3-[(3-oxo-3-pyrrolidin-1-ylpropyl)carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCC(=O)N1CCCC1)c1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C19H21N3O3S/c23-17(22-10-1-2-11-22)8-9-20-18(24)14-5-3-6-15(13-14)21-19(25)16-7-4-12-26-16/h3-7,12-13H,1-2,8-11H2,(H,20,24)(H,21,25) |
| InChIKey | IVBOVQUCZWOJRX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |