C22H29N3O4S — CID 97098299
tert-butyl N-[(2R)-1-oxo-1-[3-(thiophene-2-carbonylamino)anilino]hexan-2-yl]carbamate (PubChem CID 97098299) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-oxo-1-[3-(thiophene-2-carbonylamino)anilino]hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-oxo-1-[3-(thiophene-2-carbonylamino)anilino]hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 97098299 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | tert-butyl N-[(2R)-1-oxo-1-[3-(thiophene-2-carbonylamino)anilino]hexan-2-yl]carbamate |
| SMILES | CCCC[C@@H](NC(=O)OC(C)(C)C)C(=O)Nc1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C22H29N3O4S/c1-5-6-11-17(25-21(28)29-22(2,3)4)19(26)23-15-9-7-10-16(14-15)24-20(27)18-12-8-13-30-18/h7-10,12-14,17H,5-6,11H2,1-4H3,(H,23,26)(H,24,27)(H,25,28)/t17-/m1/s1 |
| InChIKey | CTSWGEUCCZDJNH-QGZVFWFLSA-N |
| XLogP | 5.02 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |