C18H26N2O3 — CID 86726294
tert-butyl N-[(2S)-1-anilino-1-oxohept-6-en-2-yl]carbamate (PubChem CID 86726294) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-anilino-1-oxohept-6-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-anilino-1-oxohept-6-en-2-yl]carbamate |
|---|---|
| PubChem CID | 86726294 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | tert-butyl N-[(2S)-1-anilino-1-oxohept-6-en-2-yl]carbamate |
| SMILES | C=CCCC[C@H](NC(=O)OC(C)(C)C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H26N2O3/c1-5-6-8-13-15(20-17(22)23-18(2,3)4)16(21)19-14-11-9-7-10-12-14/h5,7,9-12,15H,1,6,8,13H2,2-4H3,(H,19,21)(H,20,22)/t15-/m0/s1 |
| InChIKey | VLHYFWUAMXDMRP-HNNXBMFYSA-N |
| XLogP | 3.87 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|