C22H35NO4S — CID 102400751
tert-butyl N-[1-(benzenesulfonyl)undec-10-enyl]carbamate (PubChem CID 102400751) has the molecular formula C22H35NO4S and a molecular weight of 409.59 g/mol. Its IUPAC name is tert-butyl N-[1-(benzenesulfonyl)undec-10-enyl]carbamate.
| Compound Name | tert-butyl N-[1-(benzenesulfonyl)undec-10-enyl]carbamate |
|---|---|
| PubChem CID | 102400751 |
| Molecular Formula | C22H35NO4S |
| Molecular Weight | 409.59 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | tert-butyl N-[1-(benzenesulfonyl)undec-10-enyl]carbamate |
| SMILES | C=CCCCCCCCCC(NC(=O)OC(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H35NO4S/c1-5-6-7-8-9-10-11-15-18-20(23-21(24)27-22(2,3)4)28(25,26)19-16-13-12-14-17-19/h5,12-14,16-17,20H,1,6-11,15,18H2,2-4H3,(H,23,24) |
| InChIKey | ULZXDIFBQWUJGV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.59 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|