C20H24ClNO4S — CID 101458500
tert-butyl N-[1-(4-chlorophenyl)sulfonyl-3-phenylpropyl]carbamate (PubChem CID 101458500) has the molecular formula C20H24ClNO4S and a molecular weight of 409.94 g/mol. Its IUPAC name is tert-butyl N-[1-(4-chlorophenyl)sulfonyl-3-phenylpropyl]carbamate.
| Compound Name | tert-butyl N-[1-(4-chlorophenyl)sulfonyl-3-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 101458500 |
| Molecular Formula | C20H24ClNO4S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | tert-butyl N-[1-(4-chlorophenyl)sulfonyl-3-phenylpropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCc1ccccc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H24ClNO4S/c1-20(2,3)26-19(23)22-18(14-9-15-7-5-4-6-8-15)27(24,25)17-12-10-16(21)11-13-17/h4-8,10-13,18H,9,14H2,1-3H3,(H,22,23) |
| InChIKey | LZNFKDSUUAIRSF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |