C21H33NO6S — CID 135064321
methyl (3S)-2-(benzenesulfonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoate (PubChem CID 135064321) has the molecular formula C21H33NO6S and a molecular weight of 427.56 g/mol. Its IUPAC name is methyl (3S)-2-(benzenesulfonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoate.
| Compound Name | methyl (3S)-2-(benzenesulfonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoate |
|---|---|
| PubChem CID | 135064321 |
| Molecular Formula | C21H33NO6S |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | methyl (3S)-2-(benzenesulfonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoate |
| SMILES | CCCCCC[C@H](NC(=O)OC(C)(C)C)C(C(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H33NO6S/c1-6-7-8-12-15-17(22-20(24)28-21(2,3)4)18(19(23)27-5)29(25,26)16-13-10-9-11-14-16/h9-11,13-14,17-18H,6-8,12,15H2,1-5H3,(H,22,24)/t17-,18?/m0/s1 |
| InChIKey | CTIQIDRSDNRFPP-ZENAZSQFSA-N |
| XLogP | 3.87 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|