C15H23NO4S — CID 11758798
tert-butyl N-[(2R)-1-(benzenesulfonyl)butan-2-yl]carbamate (PubChem CID 11758798) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(benzenesulfonyl)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(benzenesulfonyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 11758798 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | tert-butyl N-[(2R)-1-(benzenesulfonyl)butan-2-yl]carbamate |
| SMILES | CC[C@H](CS(=O)(=O)c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23NO4S/c1-5-12(16-14(17)20-15(2,3)4)11-21(18,19)13-9-7-6-8-10-13/h6-10,12H,5,11H2,1-4H3,(H,16,17)/t12-/m1/s1 |
| InChIKey | ZOQWRQAXCMKIIC-GFCCVEGCSA-N |
| XLogP | 2.76 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |