C27H30FNO6S2 — CID 175456557
tert-butyl N-[4,4-bis(benzenesulfonyl)-4-fluoro-1-phenylbutan-2-yl]carbamate (PubChem CID 175456557) has the molecular formula C27H30FNO6S2 and a molecular weight of 547.67 g/mol. Its IUPAC name is tert-butyl N-[4,4-bis(benzenesulfonyl)-4-fluoro-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4,4-bis(benzenesulfonyl)-4-fluoro-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 175456557 |
| Molecular Formula | C27H30FNO6S2 |
| Molecular Weight | 547.67 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | tert-butyl N-[4,4-bis(benzenesulfonyl)-4-fluoro-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)CC(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H30FNO6S2/c1-26(2,3)35-25(30)29-22(19-21-13-7-4-8-14-21)20-27(28,36(31,32)23-15-9-5-10-16-23)37(33,34)24-17-11-6-12-18-24/h4-18,22H,19-20H2,1-3H3,(H,29,30) |
| InChIKey | KHGWMIVHSVYWKJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.67 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |