C19H29NO6S — CID 126640109
ethyl (4R)-5-(4-methylphenyl)sulfonyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 126640109) has the molecular formula C19H29NO6S and a molecular weight of 399.51 g/mol. Its IUPAC name is ethyl (4R)-5-(4-methylphenyl)sulfonyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | ethyl (4R)-5-(4-methylphenyl)sulfonyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 126640109 |
| Molecular Formula | C19H29NO6S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | ethyl (4R)-5-(4-methylphenyl)sulfonyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CCOC(=O)CC[C@H](CS(=O)(=O)c1ccc(C)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H29NO6S/c1-6-25-17(21)12-9-15(20-18(22)26-19(3,4)5)13-27(23,24)16-10-7-14(2)8-11-16/h7-8,10-11,15H,6,9,12-13H2,1-5H3,(H,20,22)/t15-/m1/s1 |
| InChIKey | YTZVMSWRZXREIK-OAHLLOKOSA-N |
| XLogP | 3.01 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |