C18H27NO7S — CID 15933197
methyl (4R)-5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 15933197) has the molecular formula C18H27NO7S and a molecular weight of 401.48 g/mol. Its IUPAC name is methyl (4R)-5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | methyl (4R)-5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 15933197 |
| Molecular Formula | C18H27NO7S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | methyl (4R)-5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | COC(=O)CC[C@H](COS(=O)(=O)c1ccc(C)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27NO7S/c1-13-6-9-15(10-7-13)27(22,23)25-12-14(8-11-16(20)24-5)19-17(21)26-18(2,3)4/h6-7,9-10,14H,8,11-12H2,1-5H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | NVVWJSURGDRQLC-CQSZACIVSA-N |
| XLogP | 2.55 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|