C16H21F2NO7S — CID 88926913
2,2-difluoro-3-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 88926913) has the molecular formula C16H21F2NO7S and a molecular weight of 409.41 g/mol. Its IUPAC name is 2,2-difluoro-3-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | 2,2-difluoro-3-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 88926913 |
| Molecular Formula | C16H21F2NO7S |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 2,2-difluoro-3-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)OC(CNC(=O)OC(C)(C)C)C(F)(F)C(=O)O)cc1 |
| InChI | InChI=1S/C16H21F2NO7S/c1-10-5-7-11(8-6-10)27(23,24)26-12(16(17,18)13(20)21)9-19-14(22)25-15(2,3)4/h5-8,12H,9H2,1-4H3,(H,19,22)(H,20,21) |
| InChIKey | BUGFKQPRHXSWDY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|