C14H21NO6S — CID 54063340
[1-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] 4-methylbenzenesulfonate (PubChem CID 54063340) has the molecular formula C14H21NO6S and a molecular weight of 331.39 g/mol. Its IUPAC name is [1-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] 4-methylbenzenesulfonate.
| Compound Name | [1-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 54063340 |
| Molecular Formula | C14H21NO6S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | [1-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(O)CNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C14H21NO6S/c1-10-5-7-11(8-6-10)22(18,19)21-12(16)9-15-13(17)20-14(2,3)4/h5-8,12,16H,9H2,1-4H3,(H,15,17) |
| InChIKey | MBGVPYXVXQMYCO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|