About [(1R)-1-hydroxybutyl] 4-methylbenzenesulfonate
[(1R)-1-hydroxybutyl] 4-methylbenzenesulfonate (PubChem CID 87258202) has the molecular formula C11H16O4S
and a molecular weight of 244.31 g/mol. Its IUPAC name is [(1R)-1-hydroxybutyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [(1R)-1-hydroxybutyl] 4-methylbenzenesulfonate |
| PubChem CID | 87258202 |
| Molecular Formula | C11H16O4S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | [(1R)-1-hydroxybutyl] 4-methylbenzenesulfonate |
| SMILES | CCC[C@H](O)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C11H16O4S/c1-3-4-11(12)15-16(13,14)10-7-5-9(2)6-8-10/h5-8,11-12H,3-4H2,1-2H3/t11-/m1/s1 |
| InChIKey | VYMFDJFUDOFOBV-LLVKDONJSA-N |
| XLogP | 1.82 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-hydroxybutyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-hydroxybutyl] 4-methylbenzenesulfonate?
The IUPAC name of [(1R)-1-hydroxybutyl] 4-methylbenzenesulfonate (CID 87258202) is [(1R)-1-hydroxybutyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [(1R)-1-hydroxybutyl] 4-methylbenzenesulfonate?
The canonical SMILES for [(1R)-1-hydroxybutyl] 4-methylbenzenesulfonate is CCC[C@H](O)OS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of [(1R)-1-hydroxybutyl] 4-methylbenzenesulfonate?
The InChIKey is VYMFDJFUDOFOBV-LLVKDONJSA-N. The full InChI is InChI=1S/C11H16O4S/c1-3-4-11(12)15-16(13,14)10-7-5-9(2)6-8-10/h5-8,11-12H,3-4H2,1-2H3/t11-/m1/s1.
What are the key properties of [(1R)-1-hydroxybutyl] 4-methylbenzenesulfonate?
[(1R)-1-hydroxybutyl] 4-methylbenzenesulfonate has a molecular weight of 244.31 g/mol, XLogP of 1.82, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-hydroxybutyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 87258202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).