C21H24FeO3S-6 — CID 87634267
1-cyclopenta-2,4-dien-1-ylbutyl 4-methylbenzenesulfonate;cyclopentane;iron (PubChem CID 87634267) has the molecular formula C21H24FeO3S-6 and a molecular weight of 412.33 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylbutyl 4-methylbenzenesulfonate;cyclopentane;iron.
| Compound Name | 1-cyclopenta-2,4-dien-1-ylbutyl 4-methylbenzenesulfonate;cyclopentane;iron |
|---|---|
| PubChem CID | 87634267 |
| Molecular Formula | C21H24FeO3S-6 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-ylbutyl 4-methylbenzenesulfonate;cyclopentane;iron |
| SMILES | CCCC(OS(=O)(=O)c1ccc(C)cc1)[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C16H19O3S.C5H5.Fe/c1-3-6-16(14-7-4-5-8-14)19-20(17,18)15-11-9-13(2)10-12-15;1-2-4-5-3-1;/h4-5,7-12,16H,3,6H2,1-2H3;1-5H;/q-1;-5; |
| InChIKey | MHLKKLMHELFBHJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|