About pentan-2-yl benzenesulfonate
pentan-2-yl benzenesulfonate (PubChem CID 89440209) has the molecular formula C11H16O3S
and a molecular weight of 228.31 g/mol. Its IUPAC name is pentan-2-yl benzenesulfonate.
Molecular Properties
| Compound Name | pentan-2-yl benzenesulfonate |
| PubChem CID | 89440209 |
| Molecular Formula | C11H16O3S |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | pentan-2-yl benzenesulfonate |
| SMILES | CCCC(C)OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H16O3S/c1-3-7-10(2)14-15(12,13)11-8-5-4-6-9-11/h4-6,8-10H,3,7H2,1-2H3 |
| InChIKey | CIYYDPXNAAGDMK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze pentan-2-yl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-yl benzenesulfonate?
The IUPAC name of pentan-2-yl benzenesulfonate (CID 89440209) is pentan-2-yl benzenesulfonate.
What is the SMILES notation for pentan-2-yl benzenesulfonate?
The canonical SMILES for pentan-2-yl benzenesulfonate is CCCC(C)OS(=O)(=O)c1ccccc1.
What is the InChIKey of pentan-2-yl benzenesulfonate?
The InChIKey is CIYYDPXNAAGDMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3S/c1-3-7-10(2)14-15(12,13)11-8-5-4-6-9-11/h4-6,8-10H,3,7H2,1-2H3.
What are the key properties of pentan-2-yl benzenesulfonate?
pentan-2-yl benzenesulfonate has a molecular weight of 228.31 g/mol, XLogP of 2.58, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-yl benzenesulfonate is sourced from PubChem (CID 89440209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).