About 5-iodohexan-2-yl benzenesulfonate
5-iodohexan-2-yl benzenesulfonate (PubChem CID 11057676) has the molecular formula C12H17IO3S
and a molecular weight of 368.24 g/mol. Its IUPAC name is 5-iodohexan-2-yl benzenesulfonate.
Molecular Properties
| Compound Name | 5-iodohexan-2-yl benzenesulfonate |
| PubChem CID | 11057676 |
| Molecular Formula | C12H17IO3S |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 5-iodohexan-2-yl benzenesulfonate |
| SMILES | CC(I)CCC(C)OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H17IO3S/c1-10(13)8-9-11(2)16-17(14,15)12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3 |
| InChIKey | ZUCNAAMAFLUYFD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 5-iodohexan-2-yl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodohexan-2-yl benzenesulfonate?
The IUPAC name of 5-iodohexan-2-yl benzenesulfonate (CID 11057676) is 5-iodohexan-2-yl benzenesulfonate.
What is the SMILES notation for 5-iodohexan-2-yl benzenesulfonate?
The canonical SMILES for 5-iodohexan-2-yl benzenesulfonate is CC(I)CCC(C)OS(=O)(=O)c1ccccc1.
What is the InChIKey of 5-iodohexan-2-yl benzenesulfonate?
The InChIKey is ZUCNAAMAFLUYFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17IO3S/c1-10(13)8-9-11(2)16-17(14,15)12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3.
What are the key properties of 5-iodohexan-2-yl benzenesulfonate?
5-iodohexan-2-yl benzenesulfonate has a molecular weight of 368.24 g/mol, XLogP of 3.38, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodohexan-2-yl benzenesulfonate is sourced from PubChem (CID 11057676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).