About (1-cyano-2-methylpropyl) benzenesulfonate
(1-cyano-2-methylpropyl) benzenesulfonate (PubChem CID 121218806) has the molecular formula C11H13NO3S
and a molecular weight of 239.30 g/mol. Its IUPAC name is (1-cyano-2-methylpropyl) benzenesulfonate.
Molecular Properties
| Compound Name | (1-cyano-2-methylpropyl) benzenesulfonate |
| PubChem CID | 121218806 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | (1-cyano-2-methylpropyl) benzenesulfonate |
| SMILES | CC(C)C(C#N)OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H13NO3S/c1-9(2)11(8-12)15-16(13,14)10-6-4-3-5-7-10/h3-7,9,11H,1-2H3 |
| InChIKey | XDWSOJHIQVRTHU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (1-cyano-2-methylpropyl) benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyano-2-methylpropyl) benzenesulfonate?
The IUPAC name of (1-cyano-2-methylpropyl) benzenesulfonate (CID 121218806) is (1-cyano-2-methylpropyl) benzenesulfonate.
What is the SMILES notation for (1-cyano-2-methylpropyl) benzenesulfonate?
The canonical SMILES for (1-cyano-2-methylpropyl) benzenesulfonate is CC(C)C(C#N)OS(=O)(=O)c1ccccc1.
What is the InChIKey of (1-cyano-2-methylpropyl) benzenesulfonate?
The InChIKey is XDWSOJHIQVRTHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3S/c1-9(2)11(8-12)15-16(13,14)10-6-4-3-5-7-10/h3-7,9,11H,1-2H3.
What are the key properties of (1-cyano-2-methylpropyl) benzenesulfonate?
(1-cyano-2-methylpropyl) benzenesulfonate has a molecular weight of 239.30 g/mol, XLogP of 1.94, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyano-2-methylpropyl) benzenesulfonate is sourced from PubChem (CID 121218806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).