C21H29O3PS — CID 134886469
1-(2,4,6-trimethylphenyl)phosphanylpentan-2-yl 4-methylbenzenesulfonate (PubChem CID 134886469) has the molecular formula C21H29O3PS and a molecular weight of 392.50 g/mol. Its IUPAC name is 1-(2,4,6-trimethylphenyl)phosphanylpentan-2-yl 4-methylbenzenesulfonate.
| Compound Name | 1-(2,4,6-trimethylphenyl)phosphanylpentan-2-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134886469 |
| Molecular Formula | C21H29O3PS |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 1-(2,4,6-trimethylphenyl)phosphanylpentan-2-yl 4-methylbenzenesulfonate |
| SMILES | CCCC(CPc1c(C)cc(C)cc1C)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H29O3PS/c1-6-7-19(14-25-21-17(4)12-16(3)13-18(21)5)24-26(22,23)20-10-8-15(2)9-11-20/h8-13,19,25H,6-7,14H2,1-5H3 |
| InChIKey | AIXCIHFQFRXKTK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|