C16H23F3O3S2 — CID 102296492
[(4R,5R)-5-(trifluoromethylsulfanyl)octan-4-yl] 4-methylbenzenesulfonate (PubChem CID 102296492) has the molecular formula C16H23F3O3S2 and a molecular weight of 384.49 g/mol. Its IUPAC name is [(4R,5R)-5-(trifluoromethylsulfanyl)octan-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [(4R,5R)-5-(trifluoromethylsulfanyl)octan-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102296492 |
| Molecular Formula | C16H23F3O3S2 |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | [(4R,5R)-5-(trifluoromethylsulfanyl)octan-4-yl] 4-methylbenzenesulfonate |
| SMILES | CCC[C@@H](OS(=O)(=O)c1ccc(C)cc1)[C@@H](CCC)SC(F)(F)F |
| InChI | InChI=1S/C16H23F3O3S2/c1-4-6-14(15(7-5-2)23-16(17,18)19)22-24(20,21)13-10-8-12(3)9-11-13/h8-11,14-15H,4-7H2,1-3H3/t14-,15-/m1/s1 |
| InChIKey | HXNWMLQUVQXOHL-HUUCEWRRSA-N |
| XLogP | 5.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|