C21H28O3S — CID 102412656
[(2R)-1-phenyloctan-2-yl] 4-methylbenzenesulfonate (PubChem CID 102412656) has the molecular formula C21H28O3S and a molecular weight of 360.52 g/mol. Its IUPAC name is [(2R)-1-phenyloctan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R)-1-phenyloctan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102412656 |
| Molecular Formula | C21H28O3S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | [(2R)-1-phenyloctan-2-yl] 4-methylbenzenesulfonate |
| SMILES | CCCCCC[C@H](Cc1ccccc1)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H28O3S/c1-3-4-5-9-12-20(17-19-10-7-6-8-11-19)24-25(22,23)21-15-13-18(2)14-16-21/h6-8,10-11,13-16,20H,3-5,9,12,17H2,1-2H3/t20-/m1/s1 |
| InChIKey | VLZZRTITAAEMAV-HXUWFJFHSA-N |
| XLogP | 5.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|