C21H26O4S — CID 102314979
[(2R)-1-oxo-1-phenyloctan-2-yl] 4-methylbenzenesulfonate (PubChem CID 102314979) has the molecular formula C21H26O4S and a molecular weight of 374.50 g/mol. Its IUPAC name is [(2R)-1-oxo-1-phenyloctan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R)-1-oxo-1-phenyloctan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102314979 |
| Molecular Formula | C21H26O4S |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [(2R)-1-oxo-1-phenyloctan-2-yl] 4-methylbenzenesulfonate |
| SMILES | CCCCCC[C@@H](OS(=O)(=O)c1ccc(C)cc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H26O4S/c1-3-4-5-9-12-20(21(22)18-10-7-6-8-11-18)25-26(23,24)19-15-13-17(2)14-16-19/h6-8,10-11,13-16,20H,3-5,9,12H2,1-2H3/t20-/m1/s1 |
| InChIKey | WWKCCQBBNOJXBY-HXUWFJFHSA-N |
| XLogP | 4.92 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|