C30H28O7S2 — CID 102295014
[1-(4-methylphenyl)-2-(4-methylphenyl)sulfonyloxy-3-oxo-3-phenylpropyl] 4-methylbenzenesulfonate (PubChem CID 102295014) has the molecular formula C30H28O7S2 and a molecular weight of 564.68 g/mol. Its IUPAC name is [1-(4-methylphenyl)-2-(4-methylphenyl)sulfonyloxy-3-oxo-3-phenylpropyl] 4-methylbenzenesulfonate.
| Compound Name | [1-(4-methylphenyl)-2-(4-methylphenyl)sulfonyloxy-3-oxo-3-phenylpropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102295014 |
| Molecular Formula | C30H28O7S2 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | [1-(4-methylphenyl)-2-(4-methylphenyl)sulfonyloxy-3-oxo-3-phenylpropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(C(OS(=O)(=O)c2ccc(C)cc2)C(OS(=O)(=O)c2ccc(C)cc2)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H28O7S2/c1-21-9-15-25(16-10-21)29(36-38(32,33)26-17-11-22(2)12-18-26)30(28(31)24-7-5-4-6-8-24)37-39(34,35)27-19-13-23(3)14-20-27/h4-20,29-30H,1-3H3 |
| InChIKey | NMKXGFORUDSXFK-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|