C31H30O7S2 — CID 135071472
[1,3-bis(4-methylphenyl)-2-(4-methylphenyl)sulfonyloxy-3-oxopropyl] 4-methylbenzenesulfonate (PubChem CID 135071472) has the molecular formula C31H30O7S2 and a molecular weight of 578.71 g/mol. Its IUPAC name is [1,3-bis(4-methylphenyl)-2-(4-methylphenyl)sulfonyloxy-3-oxopropyl] 4-methylbenzenesulfonate.
| Compound Name | [1,3-bis(4-methylphenyl)-2-(4-methylphenyl)sulfonyloxy-3-oxopropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135071472 |
| Molecular Formula | C31H30O7S2 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | [1,3-bis(4-methylphenyl)-2-(4-methylphenyl)sulfonyloxy-3-oxopropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(C(=O)C(OS(=O)(=O)c2ccc(C)cc2)C(OS(=O)(=O)c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H30O7S2/c1-21-5-13-25(14-6-21)29(32)31(38-40(35,36)28-19-11-24(4)12-20-28)30(26-15-7-22(2)8-16-26)37-39(33,34)27-17-9-23(3)10-18-27/h5-20,30-31H,1-4H3 |
| InChIKey | MRGFOCPOPHVDEM-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|