C28H30O7S — CID 87667371
bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl 4-methylbenzenesulfonate (PubChem CID 87667371) has the molecular formula C28H30O7S and a molecular weight of 510.61 g/mol. Its IUPAC name is bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl 4-methylbenzenesulfonate.
| Compound Name | bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87667371 |
| Molecular Formula | C28H30O7S |
| Molecular Weight | 510.61 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(c2ccc(C(=O)C(C)(C)O)cc2)c2ccc(C(=O)C(C)(C)O)cc2)cc1 |
| InChI | InChI=1S/C28H30O7S/c1-18-6-16-23(17-7-18)36(33,34)35-24(19-8-12-21(13-9-19)25(29)27(2,3)31)20-10-14-22(15-11-20)26(30)28(4,5)32/h6-17,24,31-32H,1-5H3 |
| InChIKey | SIIYBJUWEFITHK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|