C18H22O3S — CID 102065222
[(2R,3S)-3-(4-methylphenyl)butan-2-yl] 4-methylbenzenesulfonate (PubChem CID 102065222) has the molecular formula C18H22O3S and a molecular weight of 318.44 g/mol. Its IUPAC name is [(2R,3S)-3-(4-methylphenyl)butan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S)-3-(4-methylphenyl)butan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102065222 |
| Molecular Formula | C18H22O3S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | [(2R,3S)-3-(4-methylphenyl)butan-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc([C@H](C)[C@@H](C)OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H22O3S/c1-13-5-9-17(10-6-13)15(3)16(4)21-22(19,20)18-11-7-14(2)8-12-18/h5-12,15-16H,1-4H3/t15-,16-/m1/s1 |
| InChIKey | NGYVLKNPTXHWTB-HZPDHXFCSA-N |
| XLogP | 4.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|