About [(2R,3S)-3-(4-methylsulfanylphenyl)butan-2-yl] 4-bromobenzenesulfonate
[(2R,3S)-3-(4-methylsulfanylphenyl)butan-2-yl] 4-bromobenzenesulfonate (PubChem CID 15151871) has the molecular formula C17H19BrO3S2
and a molecular weight of 415.37 g/mol. Its IUPAC name is [(2R,3S)-3-(4-methylsulfanylphenyl)butan-2-yl] 4-bromobenzenesulfonate.
Molecular Properties
| Compound Name | [(2R,3S)-3-(4-methylsulfanylphenyl)butan-2-yl] 4-bromobenzenesulfonate |
| PubChem CID | 15151871 |
| Molecular Formula | C17H19BrO3S2 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | [(2R,3S)-3-(4-methylsulfanylphenyl)butan-2-yl] 4-bromobenzenesulfonate |
| SMILES | CSc1ccc([C@H](C)[C@@H](C)OS(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C17H19BrO3S2/c1-12(14-4-8-16(22-3)9-5-14)13(2)21-23(19,20)17-10-6-15(18)7-11-17/h4-13H,1-3H3/t12-,13-/m1/s1 |
| InChIKey | SFQRREGCWIHCRE-CHWSQXEVSA-N |
| XLogP | 5.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3S)-3-(4-methylsulfanylphenyl)butan-2-yl] 4-bromobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3S)-3-(4-methylsulfanylphenyl)butan-2-yl] 4-bromobenzenesulfonate?
The IUPAC name of [(2R,3S)-3-(4-methylsulfanylphenyl)butan-2-yl] 4-bromobenzenesulfonate (CID 15151871) is [(2R,3S)-3-(4-methylsulfanylphenyl)butan-2-yl] 4-bromobenzenesulfonate.
What is the SMILES notation for [(2R,3S)-3-(4-methylsulfanylphenyl)butan-2-yl] 4-bromobenzenesulfonate?
The canonical SMILES for [(2R,3S)-3-(4-methylsulfanylphenyl)butan-2-yl] 4-bromobenzenesulfonate is CSc1ccc([C@H](C)[C@@H](C)OS(=O)(=O)c2ccc(Br)cc2)cc1.
What is the InChIKey of [(2R,3S)-3-(4-methylsulfanylphenyl)butan-2-yl] 4-bromobenzenesulfonate?
The InChIKey is SFQRREGCWIHCRE-CHWSQXEVSA-N. The full InChI is InChI=1S/C17H19BrO3S2/c1-12(14-4-8-16(22-3)9-5-14)13(2)21-23(19,20)17-10-6-15(18)7-11-17/h4-13H,1-3H3/t12-,13-/m1/s1.
What are the key properties of [(2R,3S)-3-(4-methylsulfanylphenyl)butan-2-yl] 4-bromobenzenesulfonate?
[(2R,3S)-3-(4-methylsulfanylphenyl)butan-2-yl] 4-bromobenzenesulfonate has a molecular weight of 415.37 g/mol, XLogP of 5.07, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S)-3-(4-methylsulfanylphenyl)butan-2-yl] 4-bromobenzenesulfonate is sourced from PubChem (CID 15151871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).