C17H16BrNO3S — CID 15151886
[(2R,3S)-3-(3-cyanophenyl)butan-2-yl] 4-bromobenzenesulfonate (PubChem CID 15151886) has the molecular formula C17H16BrNO3S and a molecular weight of 394.29 g/mol. Its IUPAC name is [(2R,3S)-3-(3-cyanophenyl)butan-2-yl] 4-bromobenzenesulfonate.
| Compound Name | [(2R,3S)-3-(3-cyanophenyl)butan-2-yl] 4-bromobenzenesulfonate |
|---|---|
| PubChem CID | 15151886 |
| Molecular Formula | C17H16BrNO3S |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | [(2R,3S)-3-(3-cyanophenyl)butan-2-yl] 4-bromobenzenesulfonate |
| SMILES | C[C@@H](OS(=O)(=O)c1ccc(Br)cc1)[C@@H](C)c1cccc(C#N)c1 |
| InChI | InChI=1S/C17H16BrNO3S/c1-12(15-5-3-4-14(10-15)11-19)13(2)22-23(20,21)17-8-6-16(18)7-9-17/h3-10,12-13H,1-2H3/t12-,13-/m1/s1 |
| InChIKey | XMUZXHPCMIQVEI-CHWSQXEVSA-N |
| XLogP | 4.22 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|