C14H14BrNO2S2 — CID 3348054
4-bromo-N-[(4-methylsulfanylphenyl)methyl]benzenesulfonamide (PubChem CID 3348054) has the molecular formula C14H14BrNO2S2 and a molecular weight of 372.31 g/mol. Its IUPAC name is 4-bromo-N-[(4-methylsulfanylphenyl)methyl]benzenesulfonamide.
| Compound Name | 4-bromo-N-[(4-methylsulfanylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3348054 |
| Molecular Formula | C14H14BrNO2S2 |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 370.96 |
| IUPAC Name | 4-bromo-N-[(4-methylsulfanylphenyl)methyl]benzenesulfonamide |
| SMILES | CSc1ccc(CNS(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C14H14BrNO2S2/c1-19-13-6-2-11(3-7-13)10-16-20(17,18)14-8-4-12(15)5-9-14/h2-9,16H,10H2,1H3 |
| InChIKey | PXBJMOLRHPPIAJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |