C14H12BrF2NO3S — CID 29350986
4-bromo-N-[[4-(difluoromethoxy)phenyl]methyl]benzenesulfonamide (PubChem CID 29350986) has the molecular formula C14H12BrF2NO3S and a molecular weight of 392.22 g/mol. Its IUPAC name is 4-bromo-N-[[4-(difluoromethoxy)phenyl]methyl]benzenesulfonamide.
| Compound Name | 4-bromo-N-[[4-(difluoromethoxy)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 29350986 |
| Molecular Formula | C14H12BrF2NO3S |
| Molecular Weight | 392.22 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | 4-bromo-N-[[4-(difluoromethoxy)phenyl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccc(OC(F)F)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H12BrF2NO3S/c15-11-3-7-13(8-4-11)22(19,20)18-9-10-1-5-12(6-2-10)21-14(16)17/h1-8,14,18H,9H2 |
| InChIKey | OWJHXKOANGZSMW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |