C15H13BrF2N2O3S — CID 3885165
4-bromo-N-[1-[4-(difluoromethoxy)phenyl]ethylideneamino]benzenesulfonamide (PubChem CID 3885165) has the molecular formula C15H13BrF2N2O3S and a molecular weight of 419.25 g/mol. Its IUPAC name is 4-bromo-N-[1-[4-(difluoromethoxy)phenyl]ethylideneamino]benzenesulfonamide.
| Compound Name | 4-bromo-N-[1-[4-(difluoromethoxy)phenyl]ethylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 3885165 |
| Molecular Formula | C15H13BrF2N2O3S |
| Molecular Weight | 419.25 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | 4-bromo-N-[1-[4-(difluoromethoxy)phenyl]ethylideneamino]benzenesulfonamide |
| SMILES | CC(=NNS(=O)(=O)c1ccc(Br)cc1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H13BrF2N2O3S/c1-10(11-2-6-13(7-3-11)23-15(17)18)19-20-24(21,22)14-8-4-12(16)5-9-14/h2-9,15,20H,1H3 |
| InChIKey | IKLILAYFVAFFGI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.25 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|