C11H12F2N2O3 — CID 6113890
methyl N-[(Z)-1-[4-(difluoromethoxy)phenyl]ethylideneamino]carbamate (PubChem CID 6113890) has the molecular formula C11H12F2N2O3 and a molecular weight of 258.22 g/mol. Its IUPAC name is methyl N-[(Z)-1-[4-(difluoromethoxy)phenyl]ethylideneamino]carbamate.
| Compound Name | methyl N-[(Z)-1-[4-(difluoromethoxy)phenyl]ethylideneamino]carbamate |
|---|---|
| PubChem CID | 6113890 |
| Molecular Formula | C11H12F2N2O3 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | methyl N-[(Z)-1-[4-(difluoromethoxy)phenyl]ethylideneamino]carbamate |
| SMILES | COC(=O)N/N=C(/C)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C11H12F2N2O3/c1-7(14-15-11(16)17-2)8-3-5-9(6-4-8)18-10(12)13/h3-6,10H,1-2H3,(H,15,16)/b14-7- |
| InChIKey | BNTNXJBENZAGBR-AUWJEWJLSA-N |
| XLogP | 2.37 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|