C16H15F2N3O4 — CID 9352879
N'-[(Z)-1-[4-(difluoromethoxy)phenyl]ethylideneamino]-N-(furan-2-ylmethyl)oxamide (PubChem CID 9352879) has the molecular formula C16H15F2N3O4 and a molecular weight of 351.31 g/mol. Its IUPAC name is N'-[(Z)-1-[4-(difluoromethoxy)phenyl]ethylideneamino]-N-(furan-2-ylmethyl)oxamide.
| Compound Name | N'-[(Z)-1-[4-(difluoromethoxy)phenyl]ethylideneamino]-N-(furan-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 9352879 |
| Molecular Formula | C16H15F2N3O4 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N'-[(Z)-1-[4-(difluoromethoxy)phenyl]ethylideneamino]-N-(furan-2-ylmethyl)oxamide |
| SMILES | C/C(=N/NC(=O)C(=O)NCc1ccco1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H15F2N3O4/c1-10(11-4-6-12(7-5-11)25-16(17)18)20-21-15(23)14(22)19-9-13-3-2-8-24-13/h2-8,16H,9H2,1H3,(H,19,22)(H,21,23)/b20-10- |
| InChIKey | STEBDYKTRODSJB-JMIUGGIZSA-N |
| XLogP | 2.04 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|