C20H17F2N2O3S+ — CID 135714660
(2S)-3-[4-(difluoromethoxy)phenyl]-N-(furan-2-ylmethyl)-3-oxo-2-pyridin-1-ium-1-ylpropanethioamide (PubChem CID 135714660) has the molecular formula C20H17F2N2O3S+ and a molecular weight of 403.43 g/mol. Its IUPAC name is (2S)-3-[4-(difluoromethoxy)phenyl]-N-(furan-2-ylmethyl)-3-oxo-2-pyridin-1-ium-1-ylpropanethioamide.
| Compound Name | (2S)-3-[4-(difluoromethoxy)phenyl]-N-(furan-2-ylmethyl)-3-oxo-2-pyridin-1-ium-1-ylpropanethioamide |
|---|---|
| PubChem CID | 135714660 |
| Molecular Formula | C20H17F2N2O3S+ |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | (2S)-3-[4-(difluoromethoxy)phenyl]-N-(furan-2-ylmethyl)-3-oxo-2-pyridin-1-ium-1-ylpropanethioamide |
| SMILES | O=C(c1ccc(OC(F)F)cc1)[C@@H](C(=S)NCc1ccco1)[n+]1ccccc1 |
| InChI | InChI=1S/C20H16F2N2O3S/c21-20(22)27-15-8-6-14(7-9-15)18(25)17(24-10-2-1-3-11-24)19(28)23-13-16-5-4-12-26-16/h1-12,17,20H,13H2/p+1/t17-/m0/s1 |
| InChIKey | ZORZYFBWBWKFKB-KRWDZBQOSA-O |
| XLogP | 3.71 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|