C17H16F2N2O2S — CID 7777491
3-[4-(difluoromethoxy)phenyl]-N-ethyl-3-oxo-2-pyridin-1-ium-1-ylpropanimidothioate (PubChem CID 7777491) has the molecular formula C17H16F2N2O2S and a molecular weight of 350.39 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-N-ethyl-3-oxo-2-pyridin-1-ium-1-ylpropanimidothioate.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-N-ethyl-3-oxo-2-pyridin-1-ium-1-ylpropanimidothioate |
|---|---|
| PubChem CID | 7777491 |
| Molecular Formula | C17H16F2N2O2S |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-N-ethyl-3-oxo-2-pyridin-1-ium-1-ylpropanimidothioate |
| SMILES | CC/N=C(\[S-])C(C(=O)c1ccc(OC(F)F)cc1)[n+]1ccccc1 |
| InChI | InChI=1S/C17H16F2N2O2S/c1-2-20-16(24)14(21-10-4-3-5-11-21)15(22)12-6-8-13(9-7-12)23-17(18)19/h3-11,14,17H,2H2,1H3 |
| InChIKey | IAWAAZXUHMFLNQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|