C21H23F2N2O2S+ — CID 135753818
(2S)-3-[4-(difluoromethoxy)phenyl]-3-oxo-N-prop-2-enyl-2-(4-propylpyridin-1-ium-1-yl)propanethioamide (PubChem CID 135753818) has the molecular formula C21H23F2N2O2S+ and a molecular weight of 405.49 g/mol. Its IUPAC name is (2S)-3-[4-(difluoromethoxy)phenyl]-3-oxo-N-prop-2-enyl-2-(4-propylpyridin-1-ium-1-yl)propanethioamide.
| Compound Name | (2S)-3-[4-(difluoromethoxy)phenyl]-3-oxo-N-prop-2-enyl-2-(4-propylpyridin-1-ium-1-yl)propanethioamide |
|---|---|
| PubChem CID | 135753818 |
| Molecular Formula | C21H23F2N2O2S+ |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | (2S)-3-[4-(difluoromethoxy)phenyl]-3-oxo-N-prop-2-enyl-2-(4-propylpyridin-1-ium-1-yl)propanethioamide |
| SMILES | C=CCNC(=S)[C@H](C(=O)c1ccc(OC(F)F)cc1)[n+]1ccc(CCC)cc1 |
| InChI | InChI=1S/C21H22F2N2O2S/c1-3-5-15-10-13-25(14-11-15)18(20(28)24-12-4-2)19(26)16-6-8-17(9-7-16)27-21(22)23/h4,6-11,13-14,18,21H,2-3,5,12H2,1H3/p+1/t18-/m0/s1 |
| InChIKey | ZCQUGDYJXIGNHP-SFHVURJKSA-O |
| XLogP | 4.05 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|