C20H21F2N3O2S — CID 8653866
(2R)-3-[4-(difluoromethoxy)phenyl]-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-oxo-N-prop-2-enylpropanimidothioate (PubChem CID 8653866) has the molecular formula C20H21F2N3O2S and a molecular weight of 405.47 g/mol. Its IUPAC name is (2R)-3-[4-(difluoromethoxy)phenyl]-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-oxo-N-prop-2-enylpropanimidothioate.
| Compound Name | (2R)-3-[4-(difluoromethoxy)phenyl]-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-oxo-N-prop-2-enylpropanimidothioate |
|---|---|
| PubChem CID | 8653866 |
| Molecular Formula | C20H21F2N3O2S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | (2R)-3-[4-(difluoromethoxy)phenyl]-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-oxo-N-prop-2-enylpropanimidothioate |
| SMILES | C=CC/N=C(\[S-])[C@@H](C(=O)c1ccc(OC(F)F)cc1)[n+]1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H21F2N3O2S/c1-4-11-23-19(28)17(25-12-9-15(10-13-25)24(2)3)18(26)14-5-7-16(8-6-14)27-20(21)22/h4-10,12-13,17,20H,1,11H2,2-3H3/t17-/m1/s1 |
| InChIKey | DNGCSCMQGVZSKA-QGZVFWFLSA-N |
| XLogP | 3.20 |
| TPSA | 45.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|