C19H21N4O3S+ — CID 8714729
(2R)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-(4-nitrophenyl)-3-oxo-N-prop-2-enylpropanethioamide (PubChem CID 8714729) has the molecular formula C19H21N4O3S+ and a molecular weight of 385.47 g/mol. Its IUPAC name is (2R)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-(4-nitrophenyl)-3-oxo-N-prop-2-enylpropanethioamide.
| Compound Name | (2R)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-(4-nitrophenyl)-3-oxo-N-prop-2-enylpropanethioamide |
|---|---|
| PubChem CID | 8714729 |
| Molecular Formula | C19H21N4O3S+ |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | (2R)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-(4-nitrophenyl)-3-oxo-N-prop-2-enylpropanethioamide |
| SMILES | C=CCNC(=S)[C@@H](C(=O)c1ccc([N+](=O)[O-])cc1)[n+]1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H20N4O3S/c1-4-11-20-19(27)17(22-12-9-15(10-13-22)21(2)3)18(24)14-5-7-16(8-6-14)23(25)26/h4-10,12-13,17H,1,11H2,2-3H3/p+1/t17-/m1/s1 |
| InChIKey | MTGFDZBVNPJPGD-QGZVFWFLSA-O |
| XLogP | 2.48 |
| TPSA | 79.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|