C22H26N3O3S+ — CID 7912721
(2S)-2-(4-tert-butylpyridin-1-ium-1-yl)-3-(4-methyl-3-nitrophenyl)-3-oxo-N-prop-2-enylpropanethioamide (PubChem CID 7912721) has the molecular formula C22H26N3O3S+ and a molecular weight of 412.54 g/mol. Its IUPAC name is (2S)-2-(4-tert-butylpyridin-1-ium-1-yl)-3-(4-methyl-3-nitrophenyl)-3-oxo-N-prop-2-enylpropanethioamide.
| Compound Name | (2S)-2-(4-tert-butylpyridin-1-ium-1-yl)-3-(4-methyl-3-nitrophenyl)-3-oxo-N-prop-2-enylpropanethioamide |
|---|---|
| PubChem CID | 7912721 |
| Molecular Formula | C22H26N3O3S+ |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (2S)-2-(4-tert-butylpyridin-1-ium-1-yl)-3-(4-methyl-3-nitrophenyl)-3-oxo-N-prop-2-enylpropanethioamide |
| SMILES | C=CCNC(=S)[C@H](C(=O)c1ccc(C)c([N+](=O)[O-])c1)[n+]1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H25N3O3S/c1-6-11-23-21(29)19(24-12-9-17(10-13-24)22(3,4)5)20(26)16-8-7-15(2)18(14-16)25(27)28/h6-10,12-14,19H,1,11H2,2-5H3/p+1/t19-/m0/s1 |
| InChIKey | ZGRPHYUVDQAIHB-IBGZPJMESA-O |
| XLogP | 4.02 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|