C19H21BrN3OS+ — CID 8714677
(2R)-3-(3-bromophenyl)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-oxo-N-prop-2-enylpropanethioamide (PubChem CID 8714677) has the molecular formula C19H21BrN3OS+ and a molecular weight of 419.37 g/mol. Its IUPAC name is (2R)-3-(3-bromophenyl)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-oxo-N-prop-2-enylpropanethioamide.
| Compound Name | (2R)-3-(3-bromophenyl)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-oxo-N-prop-2-enylpropanethioamide |
|---|---|
| PubChem CID | 8714677 |
| Molecular Formula | C19H21BrN3OS+ |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | (2R)-3-(3-bromophenyl)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-oxo-N-prop-2-enylpropanethioamide |
| SMILES | C=CCNC(=S)[C@@H](C(=O)c1cccc(Br)c1)[n+]1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H20BrN3OS/c1-4-10-21-19(25)17(18(24)14-6-5-7-15(20)13-14)23-11-8-16(9-12-23)22(2)3/h4-9,11-13,17H,1,10H2,2-3H3/p+1/t17-/m1/s1 |
| InChIKey | FRUWBMKNSSTUEW-QGZVFWFLSA-O |
| XLogP | 3.33 |
| TPSA | 36.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|