C21H19N2OS2+ — CID 8714743
3-oxo-2-(3-phenylpyridin-1-ium-1-yl)-N-prop-2-enyl-3-thiophen-2-ylpropanethioamide (PubChem CID 8714743) has the molecular formula C21H19N2OS2+ and a molecular weight of 379.53 g/mol. Its IUPAC name is 3-oxo-2-(3-phenylpyridin-1-ium-1-yl)-N-prop-2-enyl-3-thiophen-2-ylpropanethioamide.
| Compound Name | 3-oxo-2-(3-phenylpyridin-1-ium-1-yl)-N-prop-2-enyl-3-thiophen-2-ylpropanethioamide |
|---|---|
| PubChem CID | 8714743 |
| Molecular Formula | C21H19N2OS2+ |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 3-oxo-2-(3-phenylpyridin-1-ium-1-yl)-N-prop-2-enyl-3-thiophen-2-ylpropanethioamide |
| SMILES | C=CCNC(=S)C(C(=O)c1cccs1)[n+]1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H18N2OS2/c1-2-12-22-21(25)19(20(24)18-11-7-14-26-18)23-13-6-10-17(15-23)16-8-4-3-5-9-16/h2-11,13-15,19H,1,12H2/p+1 |
| InChIKey | LFJYWXSLGCHGCQ-UHFFFAOYSA-O |
| XLogP | 4.23 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|